C24H40O3 — CID 11257396
6-oxohexan-2-yl (9Z,12Z,15Z)-octadeca-9,12,15-trienoate (PubChem CID 11257396) has the molecular formula C24H40O3 and a molecular weight of 376.58 g/mol. Its IUPAC name is 6-oxohexan-2-yl (9Z,12Z,15Z)-octadeca-9,12,15-trienoate.
| Compound Name | 6-oxohexan-2-yl (9Z,12Z,15Z)-octadeca-9,12,15-trienoate |
|---|---|
| PubChem CID | 11257396 |
| Molecular Formula | C24H40O3 |
| Molecular Weight | 376.58 g/mol |
| Exact Mass | 376.30 |
| IUPAC Name | 6-oxohexan-2-yl (9Z,12Z,15Z)-octadeca-9,12,15-trienoate |
| SMILES | CC/C=C\C/C=C\C/C=C\CCCCCCCC(=O)OC(C)CCCC=O |
| InChI | InChI=1S/C24H40O3/c1-3-4-5-6-7-8-9-10-11-12-13-14-15-16-17-21-24(26)27-23(2)20-18-19-22-25/h4-5,7-8,10-11,22-23H,3,6,9,12-21H2,1-2H3/b5-4-,8-7-,11-10- |
| InChIKey | QMLWOZCZBYARQP-YSTUJMKBSA-N |
| XLogP | 6.88 |
| TPSA | 43.37 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 18 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 376.58 |
| LogP ≤ 5 | 6.88 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|