6-(2,6-dioxaspiro[4.5]decan-9-yl)piperidine-2-carboxylic acid

C14H23NO4 — CID 112574004

IUPAC6-(2,6-dioxaspiro[4.5]decan-9-yl)piperidine-2-carboxylic acid
SMILESO=C(O)C1CCCC(C2CCOC3(CCOC3)C2)N1
InChIInChI=1S/C14H23NO4/c16-13(17)12-3-1-2-11(15-12)10-4-6-19-14(8-10)5-7-18-9-14/h10-12,15H,1-9H2,(H,16,17)
InChIKeyWEHBRDAEWIOXRD-UHFFFAOYSA-N
MW269.34 g/mol
LogP1.17
Rot. Bonds2

About 6-(2,6-dioxaspiro[4.5]decan-9-yl)piperidine-2-carboxylic acid

6-(2,6-dioxaspiro[4.5]decan-9-yl)piperidine-2-carboxylic acid (PubChem CID 112574004) has the molecular formula C14H23NO4 and a molecular weight of 269.34 g/mol. Its IUPAC name is 6-(2,6-dioxaspiro[4.5]decan-9-yl)piperidine-2-carboxylic acid.

Molecular Properties

Compound Name6-(2,6-dioxaspiro[4.5]decan-9-yl)piperidine-2-carboxylic acid
PubChem CID112574004
Molecular FormulaC14H23NO4
Molecular Weight269.34 g/mol
Exact Mass269.16
IUPAC Name6-(2,6-dioxaspiro[4.5]decan-9-yl)piperidine-2-carboxylic acid
SMILESO=C(O)C1CCCC(C2CCOC3(CCOC3)C2)N1
InChIInChI=1S/C14H23NO4/c16-13(17)12-3-1-2-11(15-12)10-4-6-19-14(8-10)5-7-18-9-14/h10-12,15H,1-9H2,(H,16,17)
InChIKeyWEHBRDAEWIOXRD-UHFFFAOYSA-N
XLogP1.17
TPSA67.79 Ų
H-Bond Donors2
H-Bond Acceptors4
Rotatable Bonds2
Heavy Atoms19
Complexity

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500269.34
LogP ≤ 51.17
H-Bond Donors ≤ 52
H-Bond Acceptors ≤ 104

Analyze 6-(2,6-dioxaspiro[4.5]decan-9-yl)piperidine-2-carboxylic acid with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of 6-(2,6-dioxaspiro[4.5]decan-9-yl)piperidine-2-carboxylic acid?
The IUPAC name of 6-(2,6-dioxaspiro[4.5]decan-9-yl)piperidine-2-carboxylic acid (CID 112574004) is 6-(2,6-dioxaspiro[4.5]decan-9-yl)piperidine-2-carboxylic acid.
What is the SMILES notation for 6-(2,6-dioxaspiro[4.5]decan-9-yl)piperidine-2-carboxylic acid?
The canonical SMILES for 6-(2,6-dioxaspiro[4.5]decan-9-yl)piperidine-2-carboxylic acid is O=C(O)C1CCCC(C2CCOC3(CCOC3)C2)N1.
What is the InChIKey of 6-(2,6-dioxaspiro[4.5]decan-9-yl)piperidine-2-carboxylic acid?
The InChIKey is WEHBRDAEWIOXRD-UHFFFAOYSA-N. The full InChI is InChI=1S/C14H23NO4/c16-13(17)12-3-1-2-11(15-12)10-4-6-19-14(8-10)5-7-18-9-14/h10-12,15H,1-9H2,(H,16,17).
What are the key properties of 6-(2,6-dioxaspiro[4.5]decan-9-yl)piperidine-2-carboxylic acid?
6-(2,6-dioxaspiro[4.5]decan-9-yl)piperidine-2-carboxylic acid has a molecular weight of 269.34 g/mol, XLogP of 1.17, 2 rotatable bonds, 2 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 6-(2,6-dioxaspiro[4.5]decan-9-yl)piperidine-2-carboxylic acid is sourced from PubChem (CID 112574004), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).