C15H21NO2 — CID 112574019
6-[(2,6-dimethylphenyl)methyl]piperidine-2-carboxylic acid (PubChem CID 112574019) has the molecular formula C15H21NO2 and a molecular weight of 247.34 g/mol. Its IUPAC name is 6-[(2,6-dimethylphenyl)methyl]piperidine-2-carboxylic acid.
| Compound Name | 6-[(2,6-dimethylphenyl)methyl]piperidine-2-carboxylic acid |
|---|---|
| PubChem CID | 112574019 |
| Molecular Formula | C15H21NO2 |
| Molecular Weight | 247.34 g/mol |
| Exact Mass | 247.16 |
| IUPAC Name | 6-[(2,6-dimethylphenyl)methyl]piperidine-2-carboxylic acid |
| SMILES | Cc1cccc(C)c1CC1CCCC(C(=O)O)N1 |
| InChI | InChI=1S/C15H21NO2/c1-10-5-3-6-11(2)13(10)9-12-7-4-8-14(16-12)15(17)18/h3,5-6,12,14,16H,4,7-9H2,1-2H3,(H,17,18) |
| InChIKey | HKVCFQRSXJLHNJ-UHFFFAOYSA-N |
| XLogP | 2.44 |
| TPSA | 49.33 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 247.34 |
| LogP ≤ 5 | 2.44 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |