About 6-[(2,6-dimethylphenyl)methyl]piperidine-2-carboxylic acid
6-[(2,6-dimethylphenyl)methyl]piperidine-2-carboxylic acid (PubChem CID 112574019) has the molecular formula C15H21NO2
and a molecular weight of 247.34 g/mol. Its IUPAC name is 6-[(2,6-dimethylphenyl)methyl]piperidine-2-carboxylic acid.
Molecular Properties
| Compound Name | 6-[(2,6-dimethylphenyl)methyl]piperidine-2-carboxylic acid |
| PubChem CID | 112574019 |
| Molecular Formula | C15H21NO2 |
| Molecular Weight | 247.34 g/mol |
| Exact Mass | 247.16 |
| IUPAC Name | 6-[(2,6-dimethylphenyl)methyl]piperidine-2-carboxylic acid |
| SMILES | Cc1cccc(C)c1CC1CCCC(C(=O)O)N1 |
| InChI | InChI=1S/C15H21NO2/c1-10-5-3-6-11(2)13(10)9-12-7-4-8-14(16-12)15(17)18/h3,5-6,12,14,16H,4,7-9H2,1-2H3,(H,17,18) |
| InChIKey | HKVCFQRSXJLHNJ-UHFFFAOYSA-N |
| XLogP | 2.44 |
| TPSA | 49.33 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 247.34 |
| LogP ≤ 5 | 2.44 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 6-[(2,6-dimethylphenyl)methyl]piperidine-2-carboxylic acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 6-[(2,6-dimethylphenyl)methyl]piperidine-2-carboxylic acid?
The IUPAC name of 6-[(2,6-dimethylphenyl)methyl]piperidine-2-carboxylic acid (CID 112574019) is 6-[(2,6-dimethylphenyl)methyl]piperidine-2-carboxylic acid.
What is the SMILES notation for 6-[(2,6-dimethylphenyl)methyl]piperidine-2-carboxylic acid?
The canonical SMILES for 6-[(2,6-dimethylphenyl)methyl]piperidine-2-carboxylic acid is Cc1cccc(C)c1CC1CCCC(C(=O)O)N1.
What is the InChIKey of 6-[(2,6-dimethylphenyl)methyl]piperidine-2-carboxylic acid?
The InChIKey is HKVCFQRSXJLHNJ-UHFFFAOYSA-N. The full InChI is InChI=1S/C15H21NO2/c1-10-5-3-6-11(2)13(10)9-12-7-4-8-14(16-12)15(17)18/h3,5-6,12,14,16H,4,7-9H2,1-2H3,(H,17,18).
What are the key properties of 6-[(2,6-dimethylphenyl)methyl]piperidine-2-carboxylic acid?
6-[(2,6-dimethylphenyl)methyl]piperidine-2-carboxylic acid has a molecular weight of 247.34 g/mol, XLogP of 2.44, 3 rotatable bonds, 2 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 6-[(2,6-dimethylphenyl)methyl]piperidine-2-carboxylic acid is sourced from PubChem (CID 112574019), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).