C9H5ClF4O — CID 112574814
1-chloro-3-(2,3-difluorophenyl)-1,1-difluoropropan-2-one (PubChem CID 112574814) has the molecular formula C9H5ClF4O and a molecular weight of 240.58 g/mol. Its IUPAC name is 1-chloro-3-(2,3-difluorophenyl)-1,1-difluoropropan-2-one.
| Compound Name | 1-chloro-3-(2,3-difluorophenyl)-1,1-difluoropropan-2-one |
|---|---|
| PubChem CID | 112574814 |
| Molecular Formula | C9H5ClF4O |
| Molecular Weight | 240.58 g/mol |
| Exact Mass | 240.00 |
| IUPAC Name | 1-chloro-3-(2,3-difluorophenyl)-1,1-difluoropropan-2-one |
| SMILES | O=C(Cc1cccc(F)c1F)C(F)(F)Cl |
| InChI | InChI=1S/C9H5ClF4O/c10-9(13,14)7(15)4-5-2-1-3-6(11)8(5)12/h1-3H,4H2 |
| InChIKey | KESPTLXVYUUSJA-UHFFFAOYSA-N |
| XLogP | 2.91 |
| TPSA | 17.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 240.58 |
| LogP ≤ 5 | 2.91 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|