C21H18ClN5O — CID 11257841
1-(4-chlorophenyl)-2-(3-phenoxyphenyl)-2H-1,3,5-triazine-4,6-diamine (PubChem CID 11257841) has the molecular formula C21H18ClN5O and a molecular weight of 391.86 g/mol. Its IUPAC name is 1-(4-chlorophenyl)-2-(3-phenoxyphenyl)-2H-1,3,5-triazine-4,6-diamine.
| Compound Name | 1-(4-chlorophenyl)-2-(3-phenoxyphenyl)-2H-1,3,5-triazine-4,6-diamine |
|---|---|
| PubChem CID | 11257841 |
| Molecular Formula | C21H18ClN5O |
| Molecular Weight | 391.86 g/mol |
| Exact Mass | 391.12 |
| IUPAC Name | 1-(4-chlorophenyl)-2-(3-phenoxyphenyl)-2H-1,3,5-triazine-4,6-diamine |
| SMILES | NC1=NC(c2cccc(Oc3ccccc3)c2)N(c2ccc(Cl)cc2)C(N)=N1 |
| InChI | InChI=1S/C21H18ClN5O/c22-15-9-11-16(12-10-15)27-19(25-20(23)26-21(27)24)14-5-4-8-18(13-14)28-17-6-2-1-3-7-17/h1-13,19H,(H4,23,24,25,26) |
| InChIKey | YDXKQVGSUIURRL-UHFFFAOYSA-N |
| XLogP | 4.28 |
| TPSA | 89.23 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 391.86 |
| LogP ≤ 5 | 4.28 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |