C26H39NO2 — CID 11258017
(1S)-1-[(2S,4aS,7R,8aR)-4,4,7-trimethyl-3-(2-methylprop-2-enyl)-4a,5,6,7,8,8a-hexahydro-2H-benzo[e][1,3]oxazin-2-yl]-1-phenylpent-4-en-1-ol (PubChem CID 11258017) has the molecular formula C26H39NO2 and a molecular weight of 397.60 g/mol. Its IUPAC name is (1S)-1-[(2S,4aS,7R,8aR)-4,4,7-trimethyl-3-(2-methylprop-2-enyl)-4a,5,6,7,8,8a-hexahydro-2H-benzo[e][1,3]oxazin-2-yl]-1-phenylpent-4-en-1-ol.
| Compound Name | (1S)-1-[(2S,4aS,7R,8aR)-4,4,7-trimethyl-3-(2-methylprop-2-enyl)-4a,5,6,7,8,8a-hexahydro-2H-benzo[e][1,3]oxazin-2-yl]-1-phenylpent-4-en-1-ol |
|---|---|
| PubChem CID | 11258017 |
| Molecular Formula | C26H39NO2 |
| Molecular Weight | 397.60 g/mol |
| Exact Mass | 397.30 |
| IUPAC Name | (1S)-1-[(2S,4aS,7R,8aR)-4,4,7-trimethyl-3-(2-methylprop-2-enyl)-4a,5,6,7,8,8a-hexahydro-2H-benzo[e][1,3]oxazin-2-yl]-1-phenylpent-4-en-1-ol |
| SMILES | C=CCC[C@](O)(c1ccccc1)[C@@H]1O[C@@H]2C[C@H](C)CC[C@H]2C(C)(C)N1CC(=C)C |
| InChI | InChI=1S/C26H39NO2/c1-7-8-16-26(28,21-12-10-9-11-13-21)24-27(18-19(2)3)25(5,6)22-15-14-20(4)17-23(22)29-24/h7,9-13,20,22-24,28H,1-2,8,14-18H2,3-6H3/t20-,22-,23-,24+,26+/m1/s1 |
| InChIKey | VCFDRLAMWSJEJK-FLMRIKBJSA-N |
| XLogP | 5.66 |
| TPSA | 32.70 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 397.60 |
| LogP ≤ 5 | 5.66 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|