About 3-methoxypropyl 2-chloro-3-nitrobenzoate
3-methoxypropyl 2-chloro-3-nitrobenzoate (PubChem CID 112580719) has the molecular formula C11H12ClNO5
and a molecular weight of 273.67 g/mol. Its IUPAC name is 3-methoxypropyl 2-chloro-3-nitrobenzoate.
Molecular Properties
| Compound Name | 3-methoxypropyl 2-chloro-3-nitrobenzoate |
| PubChem CID | 112580719 |
| Molecular Formula | C11H12ClNO5 |
| Molecular Weight | 273.67 g/mol |
| Exact Mass | 273.04 |
| IUPAC Name | 3-methoxypropyl 2-chloro-3-nitrobenzoate |
| SMILES | COCCCOC(=O)c1cccc([N+](=O)[O-])c1Cl |
| InChI | InChI=1S/C11H12ClNO5/c1-17-6-3-7-18-11(14)8-4-2-5-9(10(8)12)13(15)16/h2,4-5H,3,6-7H2,1H3 |
| InChIKey | RAFGXPFFLAVJSB-UHFFFAOYSA-N |
| XLogP | 2.44 |
| TPSA | 78.67 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 18 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 273.67 |
| LogP ≤ 5 | 2.44 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze 3-methoxypropyl 2-chloro-3-nitrobenzoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-methoxypropyl 2-chloro-3-nitrobenzoate?
The IUPAC name of 3-methoxypropyl 2-chloro-3-nitrobenzoate (CID 112580719) is 3-methoxypropyl 2-chloro-3-nitrobenzoate.
What is the SMILES notation for 3-methoxypropyl 2-chloro-3-nitrobenzoate?
The canonical SMILES for 3-methoxypropyl 2-chloro-3-nitrobenzoate is COCCCOC(=O)c1cccc([N+](=O)[O-])c1Cl.
What is the InChIKey of 3-methoxypropyl 2-chloro-3-nitrobenzoate?
The InChIKey is RAFGXPFFLAVJSB-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H12ClNO5/c1-17-6-3-7-18-11(14)8-4-2-5-9(10(8)12)13(15)16/h2,4-5H,3,6-7H2,1H3.
What are the key properties of 3-methoxypropyl 2-chloro-3-nitrobenzoate?
3-methoxypropyl 2-chloro-3-nitrobenzoate has a molecular weight of 273.67 g/mol, XLogP of 2.44, 6 rotatable bonds, 0 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 3-methoxypropyl 2-chloro-3-nitrobenzoate is sourced from PubChem (CID 112580719), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).