C7H14N2O4S — CID 112581200
methyl 1-(2-sulfamoylethyl)azetidine-2-carboxylate (PubChem CID 112581200) has the molecular formula C7H14N2O4S and a molecular weight of 222.27 g/mol. Its IUPAC name is methyl 1-(2-sulfamoylethyl)azetidine-2-carboxylate.
| Compound Name | methyl 1-(2-sulfamoylethyl)azetidine-2-carboxylate |
|---|---|
| PubChem CID | 112581200 |
| Molecular Formula | C7H14N2O4S |
| Molecular Weight | 222.27 g/mol |
| Exact Mass | 222.07 |
| IUPAC Name | methyl 1-(2-sulfamoylethyl)azetidine-2-carboxylate |
| SMILES | COC(=O)C1CCN1CCS(N)(=O)=O |
| InChI | InChI=1S/C7H14N2O4S/c1-13-7(10)6-2-3-9(6)4-5-14(8,11)12/h6H,2-5H2,1H3,(H2,8,11,12) |
| InChIKey | CYWNCIPHDQMCDI-UHFFFAOYSA-N |
| XLogP | -1.48 |
| TPSA | 89.70 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 222.27 |
| LogP ≤ 5 | -1.48 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |