C9H14F3NO3 — CID 112581477
methyl 1-[2-(2,2,2-trifluoroethoxy)ethyl]azetidine-2-carboxylate (PubChem CID 112581477) has the molecular formula C9H14F3NO3 and a molecular weight of 241.21 g/mol. Its IUPAC name is methyl 1-[2-(2,2,2-trifluoroethoxy)ethyl]azetidine-2-carboxylate.
| Compound Name | methyl 1-[2-(2,2,2-trifluoroethoxy)ethyl]azetidine-2-carboxylate |
|---|---|
| PubChem CID | 112581477 |
| Molecular Formula | C9H14F3NO3 |
| Molecular Weight | 241.21 g/mol |
| Exact Mass | 241.09 |
| IUPAC Name | methyl 1-[2-(2,2,2-trifluoroethoxy)ethyl]azetidine-2-carboxylate |
| SMILES | COC(=O)C1CCN1CCOCC(F)(F)F |
| InChI | InChI=1S/C9H14F3NO3/c1-15-8(14)7-2-3-13(7)4-5-16-6-9(10,11)12/h7H,2-6H2,1H3 |
| InChIKey | WUHXQGQLWFPICH-UHFFFAOYSA-N |
| XLogP | 0.81 |
| TPSA | 38.77 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 241.21 |
| LogP ≤ 5 | 0.81 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|