C12H9BrCl2N2 — CID 112581737
N-[(6-bromo-2-pyridinyl)methyl]-3,5-dichloroaniline (PubChem CID 112581737) has the molecular formula C12H9BrCl2N2 and a molecular weight of 332.03 g/mol. Its IUPAC name is N-[(6-bromo-2-pyridinyl)methyl]-3,5-dichloroaniline.
| Compound Name | N-[(6-bromo-2-pyridinyl)methyl]-3,5-dichloroaniline |
|---|---|
| PubChem CID | 112581737 |
| Molecular Formula | C12H9BrCl2N2 |
| Molecular Weight | 332.03 g/mol |
| Exact Mass | 329.93 |
| IUPAC Name | N-[(6-bromo-2-pyridinyl)methyl]-3,5-dichloroaniline |
| SMILES | Clc1cc(Cl)cc(NCc2cccc(Br)n2)c1 |
| InChI | InChI=1S/C12H9BrCl2N2/c13-12-3-1-2-10(17-12)7-16-11-5-8(14)4-9(15)6-11/h1-6,16H,7H2 |
| InChIKey | XEUYJWADPCLTNT-UHFFFAOYSA-N |
| XLogP | 4.76 |
| TPSA | 24.92 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 332.03 |
| LogP ≤ 5 | 4.76 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|