C12H8BrCl3N2 — CID 112581720
N-[(6-bromo-2-pyridinyl)methyl]-2,4,5-trichloroaniline (PubChem CID 112581720) has the molecular formula C12H8BrCl3N2 and a molecular weight of 366.47 g/mol. Its IUPAC name is N-[(6-bromo-2-pyridinyl)methyl]-2,4,5-trichloroaniline.
| Compound Name | N-[(6-bromo-2-pyridinyl)methyl]-2,4,5-trichloroaniline |
|---|---|
| PubChem CID | 112581720 |
| Molecular Formula | C12H8BrCl3N2 |
| Molecular Weight | 366.47 g/mol |
| Exact Mass | 363.89 |
| IUPAC Name | N-[(6-bromo-2-pyridinyl)methyl]-2,4,5-trichloroaniline |
| SMILES | Clc1cc(Cl)c(NCc2cccc(Br)n2)cc1Cl |
| InChI | InChI=1S/C12H8BrCl3N2/c13-12-3-1-2-7(18-12)6-17-11-5-9(15)8(14)4-10(11)16/h1-5,17H,6H2 |
| InChIKey | CRSAWZSRGVDKFT-UHFFFAOYSA-N |
| XLogP | 5.42 |
| TPSA | 24.92 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 366.47 |
| LogP ≤ 5 | 5.42 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'} |
|---|