C15H10Cl3N3 — CID 43759066
2,4,5-trichloro-N-(quinoxalin-2-ylmethyl)aniline (PubChem CID 43759066) has the molecular formula C15H10Cl3N3 and a molecular weight of 338.63 g/mol. Its IUPAC name is 2,4,5-trichloro-N-(quinoxalin-2-ylmethyl)aniline.
| Compound Name | 2,4,5-trichloro-N-(quinoxalin-2-ylmethyl)aniline |
|---|---|
| PubChem CID | 43759066 |
| Molecular Formula | C15H10Cl3N3 |
| Molecular Weight | 338.63 g/mol |
| Exact Mass | 336.99 |
| IUPAC Name | 2,4,5-trichloro-N-(quinoxalin-2-ylmethyl)aniline |
| SMILES | Clc1cc(Cl)c(NCc2cnc3ccccc3n2)cc1Cl |
| InChI | InChI=1S/C15H10Cl3N3/c16-10-5-12(18)15(6-11(10)17)20-8-9-7-19-13-3-1-2-4-14(13)21-9/h1-7,20H,8H2 |
| InChIKey | CZIYGEPOLJLPDL-UHFFFAOYSA-N |
| XLogP | 5.20 |
| TPSA | 37.81 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 338.63 |
| LogP ≤ 5 | 5.20 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'} |
|---|