C15H11Br2N3 — CID 43789270
2,5-dibromo-N-(quinoxalin-2-ylmethyl)aniline (PubChem CID 43789270) has the molecular formula C15H11Br2N3 and a molecular weight of 393.08 g/mol. Its IUPAC name is 2,5-dibromo-N-(quinoxalin-2-ylmethyl)aniline.
| Compound Name | 2,5-dibromo-N-(quinoxalin-2-ylmethyl)aniline |
|---|---|
| PubChem CID | 43789270 |
| Molecular Formula | C15H11Br2N3 |
| Molecular Weight | 393.08 g/mol |
| Exact Mass | 390.93 |
| IUPAC Name | 2,5-dibromo-N-(quinoxalin-2-ylmethyl)aniline |
| SMILES | Brc1ccc(Br)c(NCc2cnc3ccccc3n2)c1 |
| InChI | InChI=1S/C15H11Br2N3/c16-10-5-6-12(17)15(7-10)19-9-11-8-18-13-3-1-2-4-14(13)20-11/h1-8,19H,9H2 |
| InChIKey | ILMXDBFVZRMYDU-UHFFFAOYSA-N |
| XLogP | 4.77 |
| TPSA | 37.81 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 393.08 |
| LogP ≤ 5 | 4.77 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |