C12H17BrN2O — CID 112582298
N-[(6-bromo-2-pyridinyl)methyl]-2-methoxycyclopentan-1-amine (PubChem CID 112582298) has the molecular formula C12H17BrN2O and a molecular weight of 285.19 g/mol. Its IUPAC name is N-[(6-bromo-2-pyridinyl)methyl]-2-methoxycyclopentan-1-amine.
| Compound Name | N-[(6-bromo-2-pyridinyl)methyl]-2-methoxycyclopentan-1-amine |
|---|---|
| PubChem CID | 112582298 |
| Molecular Formula | C12H17BrN2O |
| Molecular Weight | 285.19 g/mol |
| Exact Mass | 284.05 |
| IUPAC Name | N-[(6-bromo-2-pyridinyl)methyl]-2-methoxycyclopentan-1-amine |
| SMILES | COC1CCCC1NCc1cccc(Br)n1 |
| InChI | InChI=1S/C12H17BrN2O/c1-16-11-6-3-5-10(11)14-8-9-4-2-7-12(13)15-9/h2,4,7,10-11,14H,3,5-6,8H2,1H3 |
| InChIKey | YIMDHPXRVSOABL-UHFFFAOYSA-N |
| XLogP | 2.50 |
| TPSA | 34.15 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 285.19 |
| LogP ≤ 5 | 2.50 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|