C13H16FNO2 — CID 112583432
1-(5-fluoro-2-pyridinyl)-2,4,4-trimethylpentane-1,3-dione (PubChem CID 112583432) has the molecular formula C13H16FNO2 and a molecular weight of 237.27 g/mol. Its IUPAC name is 1-(5-fluoro-2-pyridinyl)-2,4,4-trimethylpentane-1,3-dione.
| Compound Name | 1-(5-fluoro-2-pyridinyl)-2,4,4-trimethylpentane-1,3-dione |
|---|---|
| PubChem CID | 112583432 |
| Molecular Formula | C13H16FNO2 |
| Molecular Weight | 237.27 g/mol |
| Exact Mass | 237.12 |
| IUPAC Name | 1-(5-fluoro-2-pyridinyl)-2,4,4-trimethylpentane-1,3-dione |
| SMILES | CC(C(=O)c1ccc(F)cn1)C(=O)C(C)(C)C |
| InChI | InChI=1S/C13H16FNO2/c1-8(12(17)13(2,3)4)11(16)10-6-5-9(14)7-15-10/h5-8H,1-4H3 |
| InChIKey | VSWWLSGQSAFFGB-UHFFFAOYSA-N |
| XLogP | 2.65 |
| TPSA | 47.03 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 237.27 |
| LogP ≤ 5 | 2.65 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|