C13H18FNO3 — CID 112583457
3,3-diethoxy-1-(5-fluoro-2-pyridinyl)-2-methylpropan-1-one (PubChem CID 112583457) has the molecular formula C13H18FNO3 and a molecular weight of 255.29 g/mol. Its IUPAC name is 3,3-diethoxy-1-(5-fluoro-2-pyridinyl)-2-methylpropan-1-one.
| Compound Name | 3,3-diethoxy-1-(5-fluoro-2-pyridinyl)-2-methylpropan-1-one |
|---|---|
| PubChem CID | 112583457 |
| Molecular Formula | C13H18FNO3 |
| Molecular Weight | 255.29 g/mol |
| Exact Mass | 255.13 |
| IUPAC Name | 3,3-diethoxy-1-(5-fluoro-2-pyridinyl)-2-methylpropan-1-one |
| SMILES | CCOC(OCC)C(C)C(=O)c1ccc(F)cn1 |
| InChI | InChI=1S/C13H18FNO3/c1-4-17-13(18-5-2)9(3)12(16)11-7-6-10(14)8-15-11/h6-9,13H,4-5H2,1-3H3 |
| InChIKey | PWLKRXYIRZETLL-UHFFFAOYSA-N |
| XLogP | 2.44 |
| TPSA | 48.42 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 255.29 |
| LogP ≤ 5 | 2.44 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|