C11H11FN4 — CID 112586479
4-(5-fluoro-2-pyridinyl)-N,5-dimethylpyrimidin-2-amine (PubChem CID 112586479) has the molecular formula C11H11FN4 and a molecular weight of 218.23 g/mol. Its IUPAC name is 4-(5-fluoro-2-pyridinyl)-N,5-dimethylpyrimidin-2-amine.
| Compound Name | 4-(5-fluoro-2-pyridinyl)-N,5-dimethylpyrimidin-2-amine |
|---|---|
| PubChem CID | 112586479 |
| Molecular Formula | C11H11FN4 |
| Molecular Weight | 218.23 g/mol |
| Exact Mass | 218.10 |
| IUPAC Name | 4-(5-fluoro-2-pyridinyl)-N,5-dimethylpyrimidin-2-amine |
| SMILES | CNc1ncc(C)c(-c2ccc(F)cn2)n1 |
| InChI | InChI=1S/C11H11FN4/c1-7-5-15-11(13-2)16-10(7)9-4-3-8(12)6-14-9/h3-6H,1-2H3,(H,13,15,16) |
| InChIKey | KGIKMUOGXAUQBM-UHFFFAOYSA-N |
| XLogP | 2.03 |
| TPSA | 50.70 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 218.23 |
| LogP ≤ 5 | 2.03 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |