C13H19FN2O2 — CID 112586775
methyl 4-amino-3-ethyl-3-(5-fluoro-2-pyridinyl)pentanoate (PubChem CID 112586775) has the molecular formula C13H19FN2O2 and a molecular weight of 254.30 g/mol. Its IUPAC name is methyl 4-amino-3-ethyl-3-(5-fluoro-2-pyridinyl)pentanoate.
| Compound Name | methyl 4-amino-3-ethyl-3-(5-fluoro-2-pyridinyl)pentanoate |
|---|---|
| PubChem CID | 112586775 |
| Molecular Formula | C13H19FN2O2 |
| Molecular Weight | 254.30 g/mol |
| Exact Mass | 254.14 |
| IUPAC Name | methyl 4-amino-3-ethyl-3-(5-fluoro-2-pyridinyl)pentanoate |
| SMILES | CCC(CC(=O)OC)(c1ccc(F)cn1)C(C)N |
| InChI | InChI=1S/C13H19FN2O2/c1-4-13(9(2)15,7-12(17)18-3)11-6-5-10(14)8-16-11/h5-6,8-9H,4,7,15H2,1-3H3 |
| InChIKey | VIHJCDHKRUEJTE-UHFFFAOYSA-N |
| XLogP | 1.78 |
| TPSA | 65.21 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 254.30 |
| LogP ≤ 5 | 1.78 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |