C10H11FN4O — CID 112586926
2-amino-4-ethyl-4-(5-fluoro-2-pyridinyl)-1H-imidazol-5-one (PubChem CID 112586926) has the molecular formula C10H11FN4O and a molecular weight of 222.22 g/mol. Its IUPAC name is 2-amino-4-ethyl-4-(5-fluoro-2-pyridinyl)-1H-imidazol-5-one.
| Compound Name | 2-amino-4-ethyl-4-(5-fluoro-2-pyridinyl)-1H-imidazol-5-one |
|---|---|
| PubChem CID | 112586926 |
| Molecular Formula | C10H11FN4O |
| Molecular Weight | 222.22 g/mol |
| Exact Mass | 222.09 |
| IUPAC Name | 2-amino-4-ethyl-4-(5-fluoro-2-pyridinyl)-1H-imidazol-5-one |
| SMILES | CCC1(c2ccc(F)cn2)N=C(N)NC1=O |
| InChI | InChI=1S/C10H11FN4O/c1-2-10(8(16)14-9(12)15-10)7-4-3-6(11)5-13-7/h3-5H,2H2,1H3,(H3,12,14,15,16) |
| InChIKey | HZYGFZOTMPJIJR-UHFFFAOYSA-N |
| XLogP | 0.27 |
| TPSA | 80.37 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 222.22 |
| LogP ≤ 5 | 0.27 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |