C11H15FN2O2 — CID 118318088
5-(5-fluoro-2-pyridinyl)-2,2-dimethyl-1,3-dioxan-5-amine (PubChem CID 118318088) has the molecular formula C11H15FN2O2 and a molecular weight of 226.25 g/mol. Its IUPAC name is 5-(5-fluoro-2-pyridinyl)-2,2-dimethyl-1,3-dioxan-5-amine.
| Compound Name | 5-(5-fluoro-2-pyridinyl)-2,2-dimethyl-1,3-dioxan-5-amine |
|---|---|
| PubChem CID | 118318088 |
| Molecular Formula | C11H15FN2O2 |
| Molecular Weight | 226.25 g/mol |
| Exact Mass | 226.11 |
| IUPAC Name | 5-(5-fluoro-2-pyridinyl)-2,2-dimethyl-1,3-dioxan-5-amine |
| SMILES | CC1(C)OCC(N)(c2ccc(F)cn2)CO1 |
| InChI | InChI=1S/C11H15FN2O2/c1-10(2)15-6-11(13,7-16-10)9-4-3-8(12)5-14-9/h3-5H,6-7,13H2,1-2H3 |
| InChIKey | GBGTZQRZVMYDAU-UHFFFAOYSA-N |
| XLogP | 1.16 |
| TPSA | 57.37 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 226.25 |
| LogP ≤ 5 | 1.16 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |