C13H20BFO4 — CID 112588686
[2-fluoro-5-[2-[(2-methylpropan-2-yl)oxy]ethoxymethyl]phenyl]boronic acid (PubChem CID 112588686) has the molecular formula C13H20BFO4 and a molecular weight of 270.11 g/mol. Its IUPAC name is [2-fluoro-5-[2-[(2-methylpropan-2-yl)oxy]ethoxymethyl]phenyl]boronic acid.
| Compound Name | [2-fluoro-5-[2-[(2-methylpropan-2-yl)oxy]ethoxymethyl]phenyl]boronic acid |
|---|---|
| PubChem CID | 112588686 |
| Molecular Formula | C13H20BFO4 |
| Molecular Weight | 270.11 g/mol |
| Exact Mass | 270.14 |
| IUPAC Name | [2-fluoro-5-[2-[(2-methylpropan-2-yl)oxy]ethoxymethyl]phenyl]boronic acid |
| SMILES | CC(C)(C)OCCOCc1ccc(F)c(B(O)O)c1 |
| InChI | InChI=1S/C13H20BFO4/c1-13(2,3)19-7-6-18-9-10-4-5-12(15)11(8-10)14(16)17/h4-5,8,16-17H,6-7,9H2,1-3H3 |
| InChIKey | QRJGZZACDKOROW-UHFFFAOYSA-N |
| XLogP | 0.84 |
| TPSA | 58.92 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 270.11 |
| LogP ≤ 5 | 0.84 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|