C12H24N2O3 — CID 112589049
2-amino-2-cyclopropyl-3-[2-[(2-methylpropan-2-yl)oxy]ethoxy]propanamide (PubChem CID 112589049) has the molecular formula C12H24N2O3 and a molecular weight of 244.33 g/mol. Its IUPAC name is 2-amino-2-cyclopropyl-3-[2-[(2-methylpropan-2-yl)oxy]ethoxy]propanamide.
| Compound Name | 2-amino-2-cyclopropyl-3-[2-[(2-methylpropan-2-yl)oxy]ethoxy]propanamide |
|---|---|
| PubChem CID | 112589049 |
| Molecular Formula | C12H24N2O3 |
| Molecular Weight | 244.33 g/mol |
| Exact Mass | 244.18 |
| IUPAC Name | 2-amino-2-cyclopropyl-3-[2-[(2-methylpropan-2-yl)oxy]ethoxy]propanamide |
| SMILES | CC(C)(C)OCCOCC(N)(C(N)=O)C1CC1 |
| InChI | InChI=1S/C12H24N2O3/c1-11(2,3)17-7-6-16-8-12(14,10(13)15)9-4-5-9/h9H,4-8,14H2,1-3H3,(H2,13,15) |
| InChIKey | QCUPXVBPUDYIGT-UHFFFAOYSA-N |
| XLogP | 0.41 |
| TPSA | 87.57 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 244.33 |
| LogP ≤ 5 | 0.41 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|