C10H19NO3 — CID 63921124
2-amino-2-cyclopropyl-3-[(2-methylpropan-2-yl)oxy]propanoic acid (PubChem CID 63921124) has the molecular formula C10H19NO3 and a molecular weight of 201.27 g/mol. Its IUPAC name is 2-amino-2-cyclopropyl-3-[(2-methylpropan-2-yl)oxy]propanoic acid.
| Compound Name | 2-amino-2-cyclopropyl-3-[(2-methylpropan-2-yl)oxy]propanoic acid |
|---|---|
| PubChem CID | 63921124 |
| Molecular Formula | C10H19NO3 |
| Molecular Weight | 201.27 g/mol |
| Exact Mass | 201.14 |
| IUPAC Name | 2-amino-2-cyclopropyl-3-[(2-methylpropan-2-yl)oxy]propanoic acid |
| SMILES | CC(C)(C)OCC(N)(C(=O)O)C1CC1 |
| InChI | InChI=1S/C10H19NO3/c1-9(2,3)14-6-10(11,8(12)13)7-4-5-7/h7H,4-6,11H2,1-3H3,(H,12,13) |
| InChIKey | YXCDEZALAVJNPU-UHFFFAOYSA-N |
| XLogP | 0.99 |
| TPSA | 72.55 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 201.27 |
| LogP ≤ 5 | 0.99 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |