C15H27NO3 — CID 18966300
2-amino-2-cyclohexyl-6,6-dimethyl-4-oxoheptanoic acid (PubChem CID 18966300) has the molecular formula C15H27NO3 and a molecular weight of 269.38 g/mol. Its IUPAC name is 2-amino-2-cyclohexyl-6,6-dimethyl-4-oxoheptanoic acid.
| Compound Name | 2-amino-2-cyclohexyl-6,6-dimethyl-4-oxoheptanoic acid |
|---|---|
| PubChem CID | 18966300 |
| Molecular Formula | C15H27NO3 |
| Molecular Weight | 269.38 g/mol |
| Exact Mass | 269.20 |
| IUPAC Name | 2-amino-2-cyclohexyl-6,6-dimethyl-4-oxoheptanoic acid |
| SMILES | CC(C)(C)CC(=O)CC(N)(C(=O)O)C1CCCCC1 |
| InChI | InChI=1S/C15H27NO3/c1-14(2,3)9-12(17)10-15(16,13(18)19)11-7-5-4-6-8-11/h11H,4-10,16H2,1-3H3,(H,18,19) |
| InChIKey | GGNMRYVYGBNLCF-UHFFFAOYSA-N |
| XLogP | 2.74 |
| TPSA | 80.39 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 269.38 |
| LogP ≤ 5 | 2.74 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |