C13H23NO4 — CID 175307569
(3R)-3-amino-3-cyclopentyl-4-[(2-methylpropan-2-yl)oxy]-4-oxobutanoic acid (PubChem CID 175307569) has the molecular formula C13H23NO4 and a molecular weight of 257.33 g/mol. Its IUPAC name is (3R)-3-amino-3-cyclopentyl-4-[(2-methylpropan-2-yl)oxy]-4-oxobutanoic acid.
| Compound Name | (3R)-3-amino-3-cyclopentyl-4-[(2-methylpropan-2-yl)oxy]-4-oxobutanoic acid |
|---|---|
| PubChem CID | 175307569 |
| Molecular Formula | C13H23NO4 |
| Molecular Weight | 257.33 g/mol |
| Exact Mass | 257.16 |
| IUPAC Name | (3R)-3-amino-3-cyclopentyl-4-[(2-methylpropan-2-yl)oxy]-4-oxobutanoic acid |
| SMILES | CC(C)(C)OC(=O)[C@@](N)(CC(=O)O)C1CCCC1 |
| InChI | InChI=1S/C13H23NO4/c1-12(2,3)18-11(17)13(14,8-10(15)16)9-6-4-5-7-9/h9H,4-8,14H2,1-3H3,(H,15,16)/t13-/m1/s1 |
| InChIKey | XXPALUVMVPNSBP-CYBMUJFWSA-N |
| XLogP | 1.69 |
| TPSA | 89.62 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 257.33 |
| LogP ≤ 5 | 1.69 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |