C18H19N7O4S — CID 11258931
4-[1-[4-[2-(methylsulfonylmethylamino)ethoxy]phenyl]imidazo[4,5-c]pyridin-2-yl]-1,2,5-oxadiazol-3-amine (PubChem CID 11258931) has the molecular formula C18H19N7O4S and a molecular weight of 429.46 g/mol. Its IUPAC name is 4-[1-[4-[2-(methylsulfonylmethylamino)ethoxy]phenyl]imidazo[4,5-c]pyridin-2-yl]-1,2,5-oxadiazol-3-amine.
| Compound Name | 4-[1-[4-[2-(methylsulfonylmethylamino)ethoxy]phenyl]imidazo[4,5-c]pyridin-2-yl]-1,2,5-oxadiazol-3-amine |
|---|---|
| PubChem CID | 11258931 |
| Molecular Formula | C18H19N7O4S |
| Molecular Weight | 429.46 g/mol |
| Exact Mass | 429.12 |
| IUPAC Name | 4-[1-[4-[2-(methylsulfonylmethylamino)ethoxy]phenyl]imidazo[4,5-c]pyridin-2-yl]-1,2,5-oxadiazol-3-amine |
| SMILES | CS(=O)(=O)CNCCOc1ccc(-n2c(-c3nonc3N)nc3cnccc32)cc1 |
| InChI | InChI=1S/C18H19N7O4S/c1-30(26,27)11-21-8-9-28-13-4-2-12(3-5-13)25-15-6-7-20-10-14(15)22-18(25)16-17(19)24-29-23-16/h2-7,10,21H,8-9,11H2,1H3,(H2,19,24) |
| InChIKey | IGZGIJLASUTGEM-UHFFFAOYSA-N |
| XLogP | 1.02 |
| TPSA | 151.05 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 429.46 |
| LogP ≤ 5 | 1.02 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|