C24H21N7O4 — CID 11454226
3-[2-(4-amino-1,2,5-oxadiazol-3-yl)-1-phenylimidazo[4,5-c]pyridin-6-yl]oxy-N-(2-methoxyethyl)benzamide (PubChem CID 11454226) has the molecular formula C24H21N7O4 and a molecular weight of 471.48 g/mol. Its IUPAC name is 3-[2-(4-amino-1,2,5-oxadiazol-3-yl)-1-phenylimidazo[4,5-c]pyridin-6-yl]oxy-N-(2-methoxyethyl)benzamide.
| Compound Name | 3-[2-(4-amino-1,2,5-oxadiazol-3-yl)-1-phenylimidazo[4,5-c]pyridin-6-yl]oxy-N-(2-methoxyethyl)benzamide |
|---|---|
| PubChem CID | 11454226 |
| Molecular Formula | C24H21N7O4 |
| Molecular Weight | 471.48 g/mol |
| Exact Mass | 471.17 |
| IUPAC Name | 3-[2-(4-amino-1,2,5-oxadiazol-3-yl)-1-phenylimidazo[4,5-c]pyridin-6-yl]oxy-N-(2-methoxyethyl)benzamide |
| SMILES | COCCNC(=O)c1cccc(Oc2cc3c(cn2)nc(-c2nonc2N)n3-c2ccccc2)c1 |
| InChI | InChI=1S/C24H21N7O4/c1-33-11-10-26-24(32)15-6-5-9-17(12-15)34-20-13-19-18(14-27-20)28-23(21-22(25)30-35-29-21)31(19)16-7-3-2-4-8-16/h2-9,12-14H,10-11H2,1H3,(H2,25,30)(H,26,32) |
| InChIKey | HPWBPTHNPQDKGL-UHFFFAOYSA-N |
| XLogP | 3.22 |
| TPSA | 143.21 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 471.48 |
| LogP ≤ 5 | 3.22 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|