C16H19N3O3 — CID 122516140
3-[[4-(aminomethyl)-2-pyridinyl]oxy]-N-(2-methoxyethyl)benzamide (PubChem CID 122516140) has the molecular formula C16H19N3O3 and a molecular weight of 301.35 g/mol. Its IUPAC name is 3-[[4-(aminomethyl)-2-pyridinyl]oxy]-N-(2-methoxyethyl)benzamide.
| Compound Name | 3-[[4-(aminomethyl)-2-pyridinyl]oxy]-N-(2-methoxyethyl)benzamide |
|---|---|
| PubChem CID | 122516140 |
| Molecular Formula | C16H19N3O3 |
| Molecular Weight | 301.35 g/mol |
| Exact Mass | 301.14 |
| IUPAC Name | 3-[[4-(aminomethyl)-2-pyridinyl]oxy]-N-(2-methoxyethyl)benzamide |
| SMILES | COCCNC(=O)c1cccc(Oc2cc(CN)ccn2)c1 |
| InChI | InChI=1S/C16H19N3O3/c1-21-8-7-19-16(20)13-3-2-4-14(10-13)22-15-9-12(11-17)5-6-18-15/h2-6,9-10H,7-8,11,17H2,1H3,(H,19,20) |
| InChIKey | IUMJMWGBIFYVAC-UHFFFAOYSA-N |
| XLogP | 1.71 |
| TPSA | 86.47 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 301.35 |
| LogP ≤ 5 | 1.71 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|