C19H28N4O2 — CID 158757538
3-[[4-(aminomethyl)-6-methyl-2-pyridinyl]oxy]-N-[2-(dimethylamino)ethyl]benzamide;methane (PubChem CID 158757538) has the molecular formula C19H28N4O2 and a molecular weight of 344.46 g/mol. Its IUPAC name is 3-[[4-(aminomethyl)-6-methyl-2-pyridinyl]oxy]-N-[2-(dimethylamino)ethyl]benzamide;methane.
| Compound Name | 3-[[4-(aminomethyl)-6-methyl-2-pyridinyl]oxy]-N-[2-(dimethylamino)ethyl]benzamide;methane |
|---|---|
| PubChem CID | 158757538 |
| Molecular Formula | C19H28N4O2 |
| Molecular Weight | 344.46 g/mol |
| Exact Mass | 344.22 |
| IUPAC Name | 3-[[4-(aminomethyl)-6-methyl-2-pyridinyl]oxy]-N-[2-(dimethylamino)ethyl]benzamide;methane |
| SMILES | C.Cc1cc(CN)cc(Oc2cccc(C(=O)NCCN(C)C)c2)n1 |
| InChI | InChI=1S/C18H24N4O2.CH4/c1-13-9-14(12-19)10-17(21-13)24-16-6-4-5-15(11-16)18(23)20-7-8-22(2)3;/h4-6,9-11H,7-8,12,19H2,1-3H3,(H,20,23);1H4 |
| InChIKey | IOGHYJLBFPKPEZ-UHFFFAOYSA-N |
| XLogP | 2.57 |
| TPSA | 80.48 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 344.46 |
| LogP ≤ 5 | 2.57 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |