C22H24F3N3O4 — CID 159600487
3-[[4-(aminomethyl)-6-methyl-2-pyridinyl]oxy]-N-hex-5-ynylbenzamide;2,2,2-trifluoroacetic acid (PubChem CID 159600487) has the molecular formula C22H24F3N3O4 and a molecular weight of 451.45 g/mol. Its IUPAC name is 3-[[4-(aminomethyl)-6-methyl-2-pyridinyl]oxy]-N-hex-5-ynylbenzamide;2,2,2-trifluoroacetic acid.
| Compound Name | 3-[[4-(aminomethyl)-6-methyl-2-pyridinyl]oxy]-N-hex-5-ynylbenzamide;2,2,2-trifluoroacetic acid |
|---|---|
| PubChem CID | 159600487 |
| Molecular Formula | C22H24F3N3O4 |
| Molecular Weight | 451.45 g/mol |
| Exact Mass | 451.17 |
| IUPAC Name | 3-[[4-(aminomethyl)-6-methyl-2-pyridinyl]oxy]-N-hex-5-ynylbenzamide;2,2,2-trifluoroacetic acid |
| SMILES | C#CCCCCNC(=O)c1cccc(Oc2cc(CN)cc(C)n2)c1.O=C(O)C(F)(F)F |
| InChI | InChI=1S/C20H23N3O2.C2HF3O2/c1-3-4-5-6-10-22-20(24)17-8-7-9-18(13-17)25-19-12-16(14-21)11-15(2)23-19;3-2(4,5)1(6)7/h1,7-9,11-13H,4-6,10,14,21H2,2H3,(H,22,24);(H,6,7) |
| InChIKey | YFXSUQVAFBFAAG-UHFFFAOYSA-N |
| XLogP | 3.81 |
| TPSA | 114.54 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 451.45 |
| LogP ≤ 5 | 3.81 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|