C24H21N3O3S — CID 11258992
(5Z)-5-benzylidene-3-[5-[(E)-2-(4-methoxyphenyl)ethenyl]-3-methyl-1,2-oxazol-4-yl]-2-methylimino-1,3-thiazolidin-4-one (PubChem CID 11258992) has the molecular formula C24H21N3O3S and a molecular weight of 431.52 g/mol. Its IUPAC name is (5Z)-5-benzylidene-3-[5-[(E)-2-(4-methoxyphenyl)ethenyl]-3-methyl-1,2-oxazol-4-yl]-2-methylimino-1,3-thiazolidin-4-one.
| Compound Name | (5Z)-5-benzylidene-3-[5-[(E)-2-(4-methoxyphenyl)ethenyl]-3-methyl-1,2-oxazol-4-yl]-2-methylimino-1,3-thiazolidin-4-one |
|---|---|
| PubChem CID | 11258992 |
| Molecular Formula | C24H21N3O3S |
| Molecular Weight | 431.52 g/mol |
| Exact Mass | 431.13 |
| IUPAC Name | (5Z)-5-benzylidene-3-[5-[(E)-2-(4-methoxyphenyl)ethenyl]-3-methyl-1,2-oxazol-4-yl]-2-methylimino-1,3-thiazolidin-4-one |
| SMILES | C/N=C1\S/C(=C\c2ccccc2)C(=O)N1c1c(C)noc1/C=C/c1ccc(OC)cc1 |
| InChI | InChI=1S/C24H21N3O3S/c1-16-22(20(30-26-16)14-11-17-9-12-19(29-3)13-10-17)27-23(28)21(31-24(27)25-2)15-18-7-5-4-6-8-18/h4-15H,1-3H3/b14-11+,21-15-,25-24- |
| InChIKey | RQQONIPEWNDSCJ-WVVLFRODSA-N |
| XLogP | 5.27 |
| TPSA | 67.93 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 431.52 |
| LogP ≤ 5 | 5.27 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|