C25H20N4O2S — CID 21234096
(2E,5E)-3-[(E)-benzylideneamino]-2-[(E)-benzylidenehydrazinylidene]-5-[(4-methoxyphenyl)methylidene]-1,3-thiazolidin-4-one (PubChem CID 21234096) has the molecular formula C25H20N4O2S and a molecular weight of 440.53 g/mol. Its IUPAC name is (2E,5E)-3-[(E)-benzylideneamino]-2-[(E)-benzylidenehydrazinylidene]-5-[(4-methoxyphenyl)methylidene]-1,3-thiazolidin-4-one.
| Compound Name | (2E,5E)-3-[(E)-benzylideneamino]-2-[(E)-benzylidenehydrazinylidene]-5-[(4-methoxyphenyl)methylidene]-1,3-thiazolidin-4-one |
|---|---|
| PubChem CID | 21234096 |
| Molecular Formula | C25H20N4O2S |
| Molecular Weight | 440.53 g/mol |
| Exact Mass | 440.13 |
| IUPAC Name | (2E,5E)-3-[(E)-benzylideneamino]-2-[(E)-benzylidenehydrazinylidene]-5-[(4-methoxyphenyl)methylidene]-1,3-thiazolidin-4-one |
| SMILES | COc1ccc(/C=C2/S/C(=N/N=C/c3ccccc3)N(/N=C/c3ccccc3)C2=O)cc1 |
| InChI | InChI=1S/C25H20N4O2S/c1-31-22-14-12-19(13-15-22)16-23-24(30)29(27-18-21-10-6-3-7-11-21)25(32-23)28-26-17-20-8-4-2-5-9-20/h2-18H,1H3/b23-16+,26-17+,27-18+,28-25+ |
| InChIKey | NSYKGOPTNMOUEH-FOPLWASLSA-N |
| XLogP | 5.04 |
| TPSA | 66.62 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 440.53 |
| LogP ≤ 5 | 5.04 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|