C22H20O10 — CID 11259330
[2-(3,4-diacetyloxyphenyl)-5-hydroxy-7-methoxy-4-oxo-2,3-dihydrochromen-3-yl] acetate (PubChem CID 11259330) has the molecular formula C22H20O10 and a molecular weight of 444.39 g/mol. Its IUPAC name is [2-(3,4-diacetyloxyphenyl)-5-hydroxy-7-methoxy-4-oxo-2,3-dihydrochromen-3-yl] acetate.
| Compound Name | [2-(3,4-diacetyloxyphenyl)-5-hydroxy-7-methoxy-4-oxo-2,3-dihydrochromen-3-yl] acetate |
|---|---|
| PubChem CID | 11259330 |
| Molecular Formula | C22H20O10 |
| Molecular Weight | 444.39 g/mol |
| Exact Mass | 444.11 |
| IUPAC Name | [2-(3,4-diacetyloxyphenyl)-5-hydroxy-7-methoxy-4-oxo-2,3-dihydrochromen-3-yl] acetate |
| SMILES | COc1cc(O)c2c(c1)OC(c1ccc(OC(C)=O)c(OC(C)=O)c1)C(OC(C)=O)C2=O |
| InChI | InChI=1S/C22H20O10/c1-10(23)29-16-6-5-13(7-17(16)30-11(2)24)21-22(31-12(3)25)20(27)19-15(26)8-14(28-4)9-18(19)32-21/h5-9,21-22,26H,1-4H3 |
| InChIKey | MMCWWLJBVOQKNU-UHFFFAOYSA-N |
| XLogP | 2.50 |
| TPSA | 134.66 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 444.39 |
| LogP ≤ 5 | 2.50 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|