C35H32O15 — CID 7564629
[(2R,3S)-3-(4-acetyloxy-3-methoxyphenyl)-6-[(2R,3S)-3,5,7-triacetyloxy-4-oxo-2,3-dihydrochromen-2-yl]-2,3-dihydro-1,4-benzodioxin-2-yl]methyl acetate (PubChem CID 7564629) has the molecular formula C35H32O15 and a molecular weight of 692.63 g/mol. Its IUPAC name is [(2R,3S)-3-(4-acetyloxy-3-methoxyphenyl)-6-[(2R,3S)-3,5,7-triacetyloxy-4-oxo-2,3-dihydrochromen-2-yl]-2,3-dihydro-1,4-benzodioxin-2-yl]methyl acetate.
| Compound Name | [(2R,3S)-3-(4-acetyloxy-3-methoxyphenyl)-6-[(2R,3S)-3,5,7-triacetyloxy-4-oxo-2,3-dihydrochromen-2-yl]-2,3-dihydro-1,4-benzodioxin-2-yl]methyl acetate |
|---|---|
| PubChem CID | 7564629 |
| Molecular Formula | C35H32O15 |
| Molecular Weight | 692.63 g/mol |
| Exact Mass | 692.17 |
| IUPAC Name | [(2R,3S)-3-(4-acetyloxy-3-methoxyphenyl)-6-[(2R,3S)-3,5,7-triacetyloxy-4-oxo-2,3-dihydrochromen-2-yl]-2,3-dihydro-1,4-benzodioxin-2-yl]methyl acetate |
| SMILES | COc1cc([C@@H]2Oc3cc([C@H]4Oc5cc(OC(C)=O)cc(OC(C)=O)c5C(=O)[C@H]4OC(C)=O)ccc3O[C@@H]2COC(C)=O)ccc1OC(C)=O |
| InChI | InChI=1S/C35H32O15/c1-16(36)43-15-30-33(21-7-9-24(45-18(3)38)26(11-21)42-6)49-27-12-22(8-10-25(27)48-30)34-35(47-20(5)40)32(41)31-28(46-19(4)39)13-23(44-17(2)37)14-29(31)50-34/h7-14,30,33-35H,15H2,1-6H3/t30-,33+,34-,35-/m1/s1 |
| InChIKey | WQNWIUDROMWSFM-RRGFRYOCSA-N |
| XLogP | 4.16 |
| TPSA | 185.49 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 15 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 50 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 692.63 |
| LogP ≤ 5 | 4.16 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 15 |
| Structural Alerts | {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|