C24H20FNO5S — CID 11259535
2-[5-fluoro-2-methyl-1-[4-(3-methylphenoxy)phenyl]sulfonylindol-3-yl]acetic acid (PubChem CID 11259535) has the molecular formula C24H20FNO5S and a molecular weight of 453.49 g/mol. Its IUPAC name is 2-[5-fluoro-2-methyl-1-[4-(3-methylphenoxy)phenyl]sulfonylindol-3-yl]acetic acid.
| Compound Name | 2-[5-fluoro-2-methyl-1-[4-(3-methylphenoxy)phenyl]sulfonylindol-3-yl]acetic acid |
|---|---|
| PubChem CID | 11259535 |
| Molecular Formula | C24H20FNO5S |
| Molecular Weight | 453.49 g/mol |
| Exact Mass | 453.10 |
| IUPAC Name | 2-[5-fluoro-2-methyl-1-[4-(3-methylphenoxy)phenyl]sulfonylindol-3-yl]acetic acid |
| SMILES | Cc1cccc(Oc2ccc(S(=O)(=O)n3c(C)c(CC(=O)O)c4cc(F)ccc43)cc2)c1 |
| InChI | InChI=1S/C24H20FNO5S/c1-15-4-3-5-19(12-15)31-18-7-9-20(10-8-18)32(29,30)26-16(2)21(14-24(27)28)22-13-17(25)6-11-23(22)26/h3-13H,14H2,1-2H3,(H,27,28) |
| InChIKey | JCWXHNHANMTBRH-UHFFFAOYSA-N |
| XLogP | 5.05 |
| TPSA | 85.60 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 453.49 |
| LogP ≤ 5 | 5.05 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |