C12H16N4S — CID 112596381
N,4-dimethyl-5-(4,5,6,7-tetrahydro-1-benzothiophen-2-yl)-1,2,4-triazol-3-amine (PubChem CID 112596381) has the molecular formula C12H16N4S and a molecular weight of 248.35 g/mol. Its IUPAC name is N,4-dimethyl-5-(4,5,6,7-tetrahydro-1-benzothiophen-2-yl)-1,2,4-triazol-3-amine.
| Compound Name | N,4-dimethyl-5-(4,5,6,7-tetrahydro-1-benzothiophen-2-yl)-1,2,4-triazol-3-amine |
|---|---|
| PubChem CID | 112596381 |
| Molecular Formula | C12H16N4S |
| Molecular Weight | 248.35 g/mol |
| Exact Mass | 248.11 |
| IUPAC Name | N,4-dimethyl-5-(4,5,6,7-tetrahydro-1-benzothiophen-2-yl)-1,2,4-triazol-3-amine |
| SMILES | CNc1nnc(-c2cc3c(s2)CCCC3)n1C |
| InChI | InChI=1S/C12H16N4S/c1-13-12-15-14-11(16(12)2)10-7-8-5-3-4-6-9(8)17-10/h7H,3-6H2,1-2H3,(H,13,15) |
| InChIKey | XJAZPONBQZNHOH-UHFFFAOYSA-N |
| XLogP | 2.46 |
| TPSA | 42.74 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 248.35 |
| LogP ≤ 5 | 2.46 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |