methyl 3-(5-ethyl-6-hydroxy-2,4-dioxopyrimidin-1-yl)propanoate

C10H14N2O5 — CID 112599658

IUPACmethyl 3-(5-ethyl-6-hydroxy-2,4-dioxopyrimidin-1-yl)propanoate
SMILESCCc1c(O)n(CCC(=O)OC)c(=O)[nH]c1=O
InChIInChI=1S/C10H14N2O5/c1-3-6-8(14)11-10(16)12(9(6)15)5-4-7(13)17-2/h15H,3-5H2,1-2H3,(H,11,14,16)
InChIKeyKFDJJTPGVZMWIE-UHFFFAOYSA-N
MW242.23 g/mol
LogP-0.63
Rot. Bonds4

About methyl 3-(5-ethyl-6-hydroxy-2,4-dioxopyrimidin-1-yl)propanoate

methyl 3-(5-ethyl-6-hydroxy-2,4-dioxopyrimidin-1-yl)propanoate (PubChem CID 112599658) has the molecular formula C10H14N2O5 and a molecular weight of 242.23 g/mol. Its IUPAC name is methyl 3-(5-ethyl-6-hydroxy-2,4-dioxopyrimidin-1-yl)propanoate.

Molecular Properties

Compound Namemethyl 3-(5-ethyl-6-hydroxy-2,4-dioxopyrimidin-1-yl)propanoate
PubChem CID112599658
Molecular FormulaC10H14N2O5
Molecular Weight242.23 g/mol
Exact Mass242.09
IUPAC Namemethyl 3-(5-ethyl-6-hydroxy-2,4-dioxopyrimidin-1-yl)propanoate
SMILESCCc1c(O)n(CCC(=O)OC)c(=O)[nH]c1=O
InChIInChI=1S/C10H14N2O5/c1-3-6-8(14)11-10(16)12(9(6)15)5-4-7(13)17-2/h15H,3-5H2,1-2H3,(H,11,14,16)
InChIKeyKFDJJTPGVZMWIE-UHFFFAOYSA-N
XLogP-0.63
TPSA101.39 Ų
H-Bond Donors2
H-Bond Acceptors6
Rotatable Bonds4
Heavy Atoms17
Complexity—

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500242.23
LogP ≤ 5-0.63
H-Bond Donors ≤ 52
H-Bond Acceptors ≤ 106

Analyze methyl 3-(5-ethyl-6-hydroxy-2,4-dioxopyrimidin-1-yl)propanoate with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of methyl 3-(5-ethyl-6-hydroxy-2,4-dioxopyrimidin-1-yl)propanoate?
The IUPAC name of methyl 3-(5-ethyl-6-hydroxy-2,4-dioxopyrimidin-1-yl)propanoate (CID 112599658) is methyl 3-(5-ethyl-6-hydroxy-2,4-dioxopyrimidin-1-yl)propanoate.
What is the SMILES notation for methyl 3-(5-ethyl-6-hydroxy-2,4-dioxopyrimidin-1-yl)propanoate?
The canonical SMILES for methyl 3-(5-ethyl-6-hydroxy-2,4-dioxopyrimidin-1-yl)propanoate is CCc1c(O)n(CCC(=O)OC)c(=O)[nH]c1=O.
What is the InChIKey of methyl 3-(5-ethyl-6-hydroxy-2,4-dioxopyrimidin-1-yl)propanoate?
The InChIKey is KFDJJTPGVZMWIE-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H14N2O5/c1-3-6-8(14)11-10(16)12(9(6)15)5-4-7(13)17-2/h15H,3-5H2,1-2H3,(H,11,14,16).
What are the key properties of methyl 3-(5-ethyl-6-hydroxy-2,4-dioxopyrimidin-1-yl)propanoate?
methyl 3-(5-ethyl-6-hydroxy-2,4-dioxopyrimidin-1-yl)propanoate has a molecular weight of 242.23 g/mol, XLogP of -0.63, 4 rotatable bonds, 2 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for methyl 3-(5-ethyl-6-hydroxy-2,4-dioxopyrimidin-1-yl)propanoate is sourced from PubChem (CID 112599658), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).