C27H28N2O6 — CID 11260075
N-[2-acetyl-5-[(E)-4-morpholin-4-yl-4-oxobut-2-en-2-yl]-1-benzofuran-3-yl]-2-(4-methoxyphenyl)acetamide (PubChem CID 11260075) has the molecular formula C27H28N2O6 and a molecular weight of 476.53 g/mol. Its IUPAC name is N-[2-acetyl-5-[(E)-4-morpholin-4-yl-4-oxobut-2-en-2-yl]-1-benzofuran-3-yl]-2-(4-methoxyphenyl)acetamide.
| Compound Name | N-[2-acetyl-5-[(E)-4-morpholin-4-yl-4-oxobut-2-en-2-yl]-1-benzofuran-3-yl]-2-(4-methoxyphenyl)acetamide |
|---|---|
| PubChem CID | 11260075 |
| Molecular Formula | C27H28N2O6 |
| Molecular Weight | 476.53 g/mol |
| Exact Mass | 476.19 |
| IUPAC Name | N-[2-acetyl-5-[(E)-4-morpholin-4-yl-4-oxobut-2-en-2-yl]-1-benzofuran-3-yl]-2-(4-methoxyphenyl)acetamide |
| SMILES | COc1ccc(CC(=O)Nc2c(C(C)=O)oc3ccc(/C(C)=C/C(=O)N4CCOCC4)cc23)cc1 |
| InChI | InChI=1S/C27H28N2O6/c1-17(14-25(32)29-10-12-34-13-11-29)20-6-9-23-22(16-20)26(27(35-23)18(2)30)28-24(31)15-19-4-7-21(33-3)8-5-19/h4-9,14,16H,10-13,15H2,1-3H3,(H,28,31)/b17-14+ |
| InChIKey | KZKACOORUVDQFC-SAPNQHFASA-N |
| XLogP | 4.09 |
| TPSA | 98.08 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 476.53 |
| LogP ≤ 5 | 4.09 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|