C27H30N2O5 — CID 11305768
(E)-3-[2-acetyl-3-[[2-(4-methoxyphenyl)acetyl]amino]-1-benzofuran-5-yl]-N,N-diethylbut-2-enamide (PubChem CID 11305768) has the molecular formula C27H30N2O5 and a molecular weight of 462.55 g/mol. Its IUPAC name is (E)-3-[2-acetyl-3-[[2-(4-methoxyphenyl)acetyl]amino]-1-benzofuran-5-yl]-N,N-diethylbut-2-enamide.
| Compound Name | (E)-3-[2-acetyl-3-[[2-(4-methoxyphenyl)acetyl]amino]-1-benzofuran-5-yl]-N,N-diethylbut-2-enamide |
|---|---|
| PubChem CID | 11305768 |
| Molecular Formula | C27H30N2O5 |
| Molecular Weight | 462.55 g/mol |
| Exact Mass | 462.22 |
| IUPAC Name | (E)-3-[2-acetyl-3-[[2-(4-methoxyphenyl)acetyl]amino]-1-benzofuran-5-yl]-N,N-diethylbut-2-enamide |
| SMILES | CCN(CC)C(=O)/C=C(\C)c1ccc2oc(C(C)=O)c(NC(=O)Cc3ccc(OC)cc3)c2c1 |
| InChI | InChI=1S/C27H30N2O5/c1-6-29(7-2)25(32)14-17(3)20-10-13-23-22(16-20)26(27(34-23)18(4)30)28-24(31)15-19-8-11-21(33-5)12-9-19/h8-14,16H,6-7,15H2,1-5H3,(H,28,31)/b17-14+ |
| InChIKey | OPLGNIKQCFBYBU-SAPNQHFASA-N |
| XLogP | 5.10 |
| TPSA | 88.85 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 462.55 |
| LogP ≤ 5 | 5.10 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|