C12H15ClINO2 — CID 112604535
N-(2-chloro-4-iodophenyl)-2-[(2-methylpropan-2-yl)oxy]acetamide (PubChem CID 112604535) has the molecular formula C12H15ClINO2 and a molecular weight of 367.61 g/mol. Its IUPAC name is N-(2-chloro-4-iodophenyl)-2-[(2-methylpropan-2-yl)oxy]acetamide.
| Compound Name | N-(2-chloro-4-iodophenyl)-2-[(2-methylpropan-2-yl)oxy]acetamide |
|---|---|
| PubChem CID | 112604535 |
| Molecular Formula | C12H15ClINO2 |
| Molecular Weight | 367.61 g/mol |
| Exact Mass | 366.98 |
| IUPAC Name | N-(2-chloro-4-iodophenyl)-2-[(2-methylpropan-2-yl)oxy]acetamide |
| SMILES | CC(C)(C)OCC(=O)Nc1ccc(I)cc1Cl |
| InChI | InChI=1S/C12H15ClINO2/c1-12(2,3)17-7-11(16)15-10-5-4-8(14)6-9(10)13/h4-6H,7H2,1-3H3,(H,15,16) |
| InChIKey | UOJKMZUWCCDLSM-UHFFFAOYSA-N |
| XLogP | 3.70 |
| TPSA | 38.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 367.61 |
| LogP ≤ 5 | 3.70 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|