C11H14ClIN2O — CID 79796935
2-amino-N-(2-chloro-4-iodophenyl)-2-methylbutanamide (PubChem CID 79796935) has the molecular formula C11H14ClIN2O and a molecular weight of 352.60 g/mol. Its IUPAC name is 2-amino-N-(2-chloro-4-iodophenyl)-2-methylbutanamide.
| Compound Name | 2-amino-N-(2-chloro-4-iodophenyl)-2-methylbutanamide |
|---|---|
| PubChem CID | 79796935 |
| Molecular Formula | C11H14ClIN2O |
| Molecular Weight | 352.60 g/mol |
| Exact Mass | 351.98 |
| IUPAC Name | 2-amino-N-(2-chloro-4-iodophenyl)-2-methylbutanamide |
| SMILES | CCC(C)(N)C(=O)Nc1ccc(I)cc1Cl |
| InChI | InChI=1S/C11H14ClIN2O/c1-3-11(2,14)10(16)15-9-5-4-7(13)6-8(9)12/h4-6H,3,14H2,1-2H3,(H,15,16) |
| InChIKey | BLJJRVPBYBJVPC-UHFFFAOYSA-N |
| XLogP | 3.01 |
| TPSA | 55.12 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 352.60 |
| LogP ≤ 5 | 3.01 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|