C15H20ClNO — CID 112609951
N-[[3-chloro-2-(2-methylidenebutoxy)phenyl]methyl]cyclopropanamine (PubChem CID 112609951) has the molecular formula C15H20ClNO and a molecular weight of 265.78 g/mol. Its IUPAC name is N-[[3-chloro-2-(2-methylidenebutoxy)phenyl]methyl]cyclopropanamine.
| Compound Name | N-[[3-chloro-2-(2-methylidenebutoxy)phenyl]methyl]cyclopropanamine |
|---|---|
| PubChem CID | 112609951 |
| Molecular Formula | C15H20ClNO |
| Molecular Weight | 265.78 g/mol |
| Exact Mass | 265.12 |
| IUPAC Name | N-[[3-chloro-2-(2-methylidenebutoxy)phenyl]methyl]cyclopropanamine |
| SMILES | C=C(CC)COc1c(Cl)cccc1CNC1CC1 |
| InChI | InChI=1S/C15H20ClNO/c1-3-11(2)10-18-15-12(5-4-6-14(15)16)9-17-13-7-8-13/h4-6,13,17H,2-3,7-10H2,1H3 |
| InChIKey | NEUITWRXUGBEPF-UHFFFAOYSA-N |
| XLogP | 3.94 |
| TPSA | 21.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 265.78 |
| LogP ≤ 5 | 3.94 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|