C14H9ClF2O2 — CID 112611434
3-chloro-2-[(2,5-difluorophenyl)methoxy]benzaldehyde (PubChem CID 112611434) has the molecular formula C14H9ClF2O2 and a molecular weight of 282.67 g/mol. Its IUPAC name is 3-chloro-2-[(2,5-difluorophenyl)methoxy]benzaldehyde.
| Compound Name | 3-chloro-2-[(2,5-difluorophenyl)methoxy]benzaldehyde |
|---|---|
| PubChem CID | 112611434 |
| Molecular Formula | C14H9ClF2O2 |
| Molecular Weight | 282.67 g/mol |
| Exact Mass | 282.03 |
| IUPAC Name | 3-chloro-2-[(2,5-difluorophenyl)methoxy]benzaldehyde |
| SMILES | O=Cc1cccc(Cl)c1OCc1cc(F)ccc1F |
| InChI | InChI=1S/C14H9ClF2O2/c15-12-3-1-2-9(7-18)14(12)19-8-10-6-11(16)4-5-13(10)17/h1-7H,8H2 |
| InChIKey | QAAYNMBORRVANC-UHFFFAOYSA-N |
| XLogP | 4.01 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 282.67 |
| LogP ≤ 5 | 4.01 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|