C12H12ClN3O3 — CID 112611929
3-chloro-2-[(2-ethyl-1,2,4-triazol-3-yl)methoxy]benzoic acid (PubChem CID 112611929) has the molecular formula C12H12ClN3O3 and a molecular weight of 281.70 g/mol. Its IUPAC name is 3-chloro-2-[(2-ethyl-1,2,4-triazol-3-yl)methoxy]benzoic acid.
| Compound Name | 3-chloro-2-[(2-ethyl-1,2,4-triazol-3-yl)methoxy]benzoic acid |
|---|---|
| PubChem CID | 112611929 |
| Molecular Formula | C12H12ClN3O3 |
| Molecular Weight | 281.70 g/mol |
| Exact Mass | 281.06 |
| IUPAC Name | 3-chloro-2-[(2-ethyl-1,2,4-triazol-3-yl)methoxy]benzoic acid |
| SMILES | CCn1ncnc1COc1c(Cl)cccc1C(=O)O |
| InChI | InChI=1S/C12H12ClN3O3/c1-2-16-10(14-7-15-16)6-19-11-8(12(17)18)4-3-5-9(11)13/h3-5,7H,2,6H2,1H3,(H,17,18) |
| InChIKey | TXOXHAUXCCFMMR-UHFFFAOYSA-N |
| XLogP | 2.23 |
| TPSA | 77.24 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 281.70 |
| LogP ≤ 5 | 2.23 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |