C12H13ClN4O2 — CID 115547805
(2-ethyl-1,2,4-triazol-3-yl)methyl 2-amino-3-chlorobenzoate (PubChem CID 115547805) has the molecular formula C12H13ClN4O2 and a molecular weight of 280.71 g/mol. Its IUPAC name is (2-ethyl-1,2,4-triazol-3-yl)methyl 2-amino-3-chlorobenzoate.
| Compound Name | (2-ethyl-1,2,4-triazol-3-yl)methyl 2-amino-3-chlorobenzoate |
|---|---|
| PubChem CID | 115547805 |
| Molecular Formula | C12H13ClN4O2 |
| Molecular Weight | 280.71 g/mol |
| Exact Mass | 280.07 |
| IUPAC Name | (2-ethyl-1,2,4-triazol-3-yl)methyl 2-amino-3-chlorobenzoate |
| SMILES | CCn1ncnc1COC(=O)c1cccc(Cl)c1N |
| InChI | InChI=1S/C12H13ClN4O2/c1-2-17-10(15-7-16-17)6-19-12(18)8-4-3-5-9(13)11(8)14/h3-5,7H,2,6,14H2,1H3 |
| InChIKey | NXFWZVJOIGOLAY-UHFFFAOYSA-N |
| XLogP | 1.89 |
| TPSA | 83.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 280.71 |
| LogP ≤ 5 | 1.89 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|