C13H13Cl2N3O2 — CID 115619516
(5-chloro-1,3-dimethylpyrazol-4-yl)methyl 2-amino-3-chlorobenzoate (PubChem CID 115619516) has the molecular formula C13H13Cl2N3O2 and a molecular weight of 314.17 g/mol. Its IUPAC name is (5-chloro-1,3-dimethylpyrazol-4-yl)methyl 2-amino-3-chlorobenzoate.
| Compound Name | (5-chloro-1,3-dimethylpyrazol-4-yl)methyl 2-amino-3-chlorobenzoate |
|---|---|
| PubChem CID | 115619516 |
| Molecular Formula | C13H13Cl2N3O2 |
| Molecular Weight | 314.17 g/mol |
| Exact Mass | 313.04 |
| IUPAC Name | (5-chloro-1,3-dimethylpyrazol-4-yl)methyl 2-amino-3-chlorobenzoate |
| SMILES | Cc1nn(C)c(Cl)c1COC(=O)c1cccc(Cl)c1N |
| InChI | InChI=1S/C13H13Cl2N3O2/c1-7-9(12(15)18(2)17-7)6-20-13(19)8-4-3-5-10(14)11(8)16/h3-5H,6,16H2,1-2H3 |
| InChIKey | HMVOKOFKGOXCHU-UHFFFAOYSA-N |
| XLogP | 2.97 |
| TPSA | 70.14 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 314.17 |
| LogP ≤ 5 | 2.97 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|