C11H10F4O4 — CID 112612202
3-fluoro-2-[2-(2,2,2-trifluoroethoxy)ethoxy]benzoic acid (PubChem CID 112612202) has the molecular formula C11H10F4O4 and a molecular weight of 282.19 g/mol. Its IUPAC name is 3-fluoro-2-[2-(2,2,2-trifluoroethoxy)ethoxy]benzoic acid.
| Compound Name | 3-fluoro-2-[2-(2,2,2-trifluoroethoxy)ethoxy]benzoic acid |
|---|---|
| PubChem CID | 112612202 |
| Molecular Formula | C11H10F4O4 |
| Molecular Weight | 282.19 g/mol |
| Exact Mass | 282.05 |
| IUPAC Name | 3-fluoro-2-[2-(2,2,2-trifluoroethoxy)ethoxy]benzoic acid |
| SMILES | O=C(O)c1cccc(F)c1OCCOCC(F)(F)F |
| InChI | InChI=1S/C11H10F4O4/c12-8-3-1-2-7(10(16)17)9(8)19-5-4-18-6-11(13,14)15/h1-3H,4-6H2,(H,16,17) |
| InChIKey | MDNMOEILNXFOTM-UHFFFAOYSA-N |
| XLogP | 2.48 |
| TPSA | 55.76 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 282.19 |
| LogP ≤ 5 | 2.48 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|