C11H14ClNO3 — CID 112612856
2-[2-chloro-6-(hydroxymethyl)phenoxy]butanamide (PubChem CID 112612856) has the molecular formula C11H14ClNO3 and a molecular weight of 243.69 g/mol. Its IUPAC name is 2-[2-chloro-6-(hydroxymethyl)phenoxy]butanamide.
| Compound Name | 2-[2-chloro-6-(hydroxymethyl)phenoxy]butanamide |
|---|---|
| PubChem CID | 112612856 |
| Molecular Formula | C11H14ClNO3 |
| Molecular Weight | 243.69 g/mol |
| Exact Mass | 243.07 |
| IUPAC Name | 2-[2-chloro-6-(hydroxymethyl)phenoxy]butanamide |
| SMILES | CCC(Oc1c(Cl)cccc1CO)C(N)=O |
| InChI | InChI=1S/C11H14ClNO3/c1-2-9(11(13)15)16-10-7(6-14)4-3-5-8(10)12/h3-5,9,14H,2,6H2,1H3,(H2,13,15) |
| InChIKey | UZWVIPNNSKOYPU-UHFFFAOYSA-N |
| XLogP | 1.48 |
| TPSA | 72.55 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 243.69 |
| LogP ≤ 5 | 1.48 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |