C11H10FNO2S — CID 112613201
[3-fluoro-2-(1,3-thiazol-2-ylmethoxy)phenyl]methanol (PubChem CID 112613201) has the molecular formula C11H10FNO2S and a molecular weight of 239.27 g/mol. Its IUPAC name is [3-fluoro-2-(1,3-thiazol-2-ylmethoxy)phenyl]methanol.
| Compound Name | [3-fluoro-2-(1,3-thiazol-2-ylmethoxy)phenyl]methanol |
|---|---|
| PubChem CID | 112613201 |
| Molecular Formula | C11H10FNO2S |
| Molecular Weight | 239.27 g/mol |
| Exact Mass | 239.04 |
| IUPAC Name | [3-fluoro-2-(1,3-thiazol-2-ylmethoxy)phenyl]methanol |
| SMILES | OCc1cccc(F)c1OCc1nccs1 |
| InChI | InChI=1S/C11H10FNO2S/c12-9-3-1-2-8(6-14)11(9)15-7-10-13-4-5-16-10/h1-5,14H,6-7H2 |
| InChIKey | SKCWZNMGRWGJTN-UHFFFAOYSA-N |
| XLogP | 2.35 |
| TPSA | 42.35 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 239.27 |
| LogP ≤ 5 | 2.35 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |