C12H14ClFO2 — CID 112613634
2-[[2-(chloromethyl)-6-fluorophenoxy]methyl]oxolane (PubChem CID 112613634) has the molecular formula C12H14ClFO2 and a molecular weight of 244.69 g/mol. Its IUPAC name is 2-[[2-(chloromethyl)-6-fluorophenoxy]methyl]oxolane.
| Compound Name | 2-[[2-(chloromethyl)-6-fluorophenoxy]methyl]oxolane |
|---|---|
| PubChem CID | 112613634 |
| Molecular Formula | C12H14ClFO2 |
| Molecular Weight | 244.69 g/mol |
| Exact Mass | 244.07 |
| IUPAC Name | 2-[[2-(chloromethyl)-6-fluorophenoxy]methyl]oxolane |
| SMILES | Fc1cccc(CCl)c1OCC1CCCO1 |
| InChI | InChI=1S/C12H14ClFO2/c13-7-9-3-1-5-11(14)12(9)16-8-10-4-2-6-15-10/h1,3,5,10H,2,4,6-8H2 |
| InChIKey | QHKYFRJHPAIJPW-UHFFFAOYSA-N |
| XLogP | 3.12 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 244.69 |
| LogP ≤ 5 | 3.12 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|